Index of /starwort/judgetower
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | judge-tower.zip | 2024-08-19 11:27 | 303M | |
![[IMG]](/icons/image2.gif) | Chains of Mephistoph..> | 2024-08-19 10:21 | 2.1M | |
![[IMG]](/icons/image2.gif) | Wrath of God-sum-46.png | 2024-08-19 10:21 | 2.1M | |
![[IMG]](/icons/image2.gif) | Raging River-2ed-169..> | 2024-08-19 10:21 | 2.1M | |
![[IMG]](/icons/image2.gif) | Illusionary Mask-2ed..> | 2024-08-19 10:21 | 2.1M | |
![[IMG]](/icons/image2.gif) | Ice Cauldron-ice-321..> | 2024-08-19 10:21 | 2.0M | |
![[IMG]](/icons/image2.gif) | Baton of Morale-ice-..> | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Phyrexian Devourer-a..> | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Wheel of Fortune-sum..> | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Mirrorweave-c16-234.png | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Takklemaggot-chr-37.png | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Lim-Dûl's Vault-all..> | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Pyroblast-5ed-262.png | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Akroma's Memorial-fu..> | 2024-08-19 10:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | Might Makes Right-m1..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Swamp-m15-260.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Vedalken Orrery-cns-..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Fecundity-8ed-247.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Mountain-m15-263.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Wild Pair-plc-144.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Portent-5ed-110.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Wheel of Fate-plst-C..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Despondency-usg-129.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Tidings-9ed-106.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Icatian Moneychanger..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Sudden Spoiling-c14-..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Temple Bell-c13-265.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Gruul Ragebeast-gtc-..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Garruk's Horde-w17-2..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Hive Mind-m10-54.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | See the Unwritten-kt..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Staff of Domination-..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Gamekeeper-cns-165.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Opal Gargoyle-usg-25..> | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Humility-tmp-24.png | 2024-08-19 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Scoria Wurm-10e-227.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Nether Shadow-4ed-14..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Forest-ori-272.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Telim'Tor's Edict-mi..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Amber Prison-6ed-272..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Palinchron-ulg-38.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Praetor's Grasp-nph-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Myr Propagator-som-1..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Torrent of Lava-mir-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Ancestral Memories-7..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Bazaar Trader-wwk-72..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Dubious Challenge-kl..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Rings of Brightheart..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Bludgeon Brawl-nph-8..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Contagion Engine-som..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Moonring Mirror-chk-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Soul of the Harvest-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Opalescence-uds-13.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Living End-tsp-115.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Conflux-con-102.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Oracle en-Vec-tmp-31..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Deathgreeter-ala-71.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | March of the Machine..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Winding Constrictor-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Norin the Wary-tsp-1..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Endless Whispers-5dn..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Magus of the Taberna..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Temporal Distortion-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Abeyance-wth-1.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Reverberate-m12-152.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Iona, Shield of Emer..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Confusion in the Ran..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Prosperity-vis-40.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Dead Ringers-apc-37.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Teferi's Realm-vis-4..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Flaming Gambit-tor-9..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Academy Ruins-tsp-26..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Consecrated Sphinx-m..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Time Stop-10e-117.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Warp World-rav-150.png | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Doubling Season-rav-..> | 2024-08-19 10:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | Evolutionary Leap-ts..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Mass Hysteria-mrd-99..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Erase-ktk-9.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Cephalid Illusionist..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Guild Feud-rtr-97.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Thopter Assembly-ddu..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Wild Guess-m13-157.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Chronosavant-tsp-9.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Genesis Chamber-dst-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Djinn Illuminatus-gp..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Aether Membrane-ddi-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Mosswort Bridge-c20-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Shifting Shadow-nec-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Panglacial Wurm-plst..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Timesifter-mrd-262.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Master of the Feast-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Seize the Soul-gpt-6..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Prototype Portal-c18..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Jabari's Influence-m..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Vault of Whispers-mr..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Green Sun's Zenith-m..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Archaeomancer-m14-43..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Knowledge Pool-mbs-1..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Dualcaster Mage-ema-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Millikin-mh2-297.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Healer's Headdress-5..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Dominus of Fealty-pl..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Oblivion Ring-m12-27..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Rite of Replication-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Teferi's Imp-mir-98.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Familiar's Ruse-mm3-..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Seasons Past-soi-226..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Perplexing Chimera-b..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Hamletback Goliath-c..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Jötun Grunt-plst-CS..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Cauldron of Souls-cm..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Tibalt, the Fiend-Bl..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Geistblast-soi-160.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Aethermage's Touch-c..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Paradox Haze-tsp-71.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Tomorrow, Azami's Fa..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Reforge the Soul-avr..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Mikaeus, the Unhallo..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Sylvan Library-ema-1..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Gifts Ungiven-ss1-5.png | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Mesmeric Orb-2xm-272..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Jace's Mindseeker-dd..> | 2024-08-19 10:21 | 1.6M | |
![[IMG]](/icons/image2.gif) | Disciple of Bolas-c2..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Mycosynth Lattice-bb..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Howling Mine-brr-20.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Parallax Wave-plst-N..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Strionic Resonator-c..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Conjured Currency-rt..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Counterbalance-csp-3..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Commandeer-otp-9.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Spell Queller-emn-18..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Back from the Brink-..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Seat of the Synod-mr..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Balance-sld-173.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Fractured Loyalty-mr..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Reassembling Skeleto..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Necropotence-ema-98.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Maelstrom Nexus-plst..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Ghastly Conscription..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Hex-c19-120.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Galepowder Mage-ddi-..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Island-soi-288.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Unburial Rites-uma-1..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Arjun, the Shifting ..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Notion Thief-znc-96.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Bounty of the Luxa-2..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Upheaval-mh2-270.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Jeskai Ascendancy-2x..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Cast Through Time-ro..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Eye of the Storm-rav..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Undead Alchemist-mic..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Plains-m21-261.png | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Rekindling Phoenix-n..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Archmage Ascension-z..> | 2024-08-19 10:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | Venser, Shaper Savan..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Drogskol Reaver-2x2-..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Assemble the Legion-..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Elesh Norn, Grand Ce..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Archangel of Thune-i..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Chain Lightning-dmr-..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Mind's Desire-c21-12..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Brainstorm-ddj-13.png | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Triad of Fates-ths-2..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Chain Reaction-scd-1..> | 2024-08-19 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Mentor of the Meek-o..> | 2024-08-19 10:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | Teferi's Protection-..> | 2024-08-19 10:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | Abundance-cmm-884.png | 2024-08-19 10:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | Fact or Fiction-dmr-..> | 2024-08-19 10:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | Icatian Javelineers-..> | 2024-08-19 10:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | Sangromancer-scd-103..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Illusionist's Bracer..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Exalted Angel-mkc-63..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Whisperwood Elementa..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Waste Not-wot-38.png | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Yisan, the Wanderer ..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Oviya Pashiri, Sage ..> | 2024-08-19 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | Epic Experiment-otc-..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Snakeform-clu-209.png | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Tidespout Tyrant-rvr..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Selvala, Explorer Re..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Deadbridge Chant-m3c..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Edric, Spymaster of ..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Copy Enchantment-rvr..> | 2024-08-19 10:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | Necromancy-mkc-131.png | 2024-08-19 10:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | Greater Good-blc-223..> | 2024-08-19 10:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | Panharmonicon-pip-23..> | 2024-08-19 10:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | Plea for Power-ltc-1..> | 2024-08-19 10:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | Sun Titan-blc-157.png | 2024-08-19 10:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | Chasm Skulker-blc-16..> | 2024-08-19 10:21 | 958K | |
![[IMG]](/icons/image2.gif) | Royal Assassin-acr-9..> | 2024-08-19 10:21 | 957K | |
![[IMG]](/icons/image2.gif) | Inexorable Tide-pip-..> | 2024-08-19 10:21 | 953K | |
![[IMG]](/icons/image2.gif) | Living Death-ltc-203..> | 2024-08-19 10:21 | 888K | |
![[IMG]](/icons/image2.gif) | Fatal Push-acr-90.png | 2024-08-19 10:21 | 874K | |
|