Index of /starwort/judgetower
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Fatal Push-acr-90.png | 2024-08-19 10:21 | 874K | |
| Living Death-ltc-203..> | 2024-08-19 10:21 | 888K | |
| Inexorable Tide-pip-..> | 2024-08-19 10:21 | 953K | |
| Royal Assassin-acr-9..> | 2024-08-19 10:21 | 957K | |
| Chasm Skulker-blc-16..> | 2024-08-19 10:21 | 958K | |
| Sun Titan-blc-157.png | 2024-08-19 10:21 | 1.0M | |
| Plea for Power-ltc-1..> | 2024-08-19 10:21 | 1.0M | |
| Panharmonicon-pip-23..> | 2024-08-19 10:21 | 1.0M | |
| Greater Good-blc-223..> | 2024-08-19 10:21 | 1.0M | |
| Necromancy-mkc-131.png | 2024-08-19 10:21 | 1.0M | |
| Copy Enchantment-rvr..> | 2024-08-19 10:21 | 1.1M | |
| Edric, Spymaster of ..> | 2024-08-19 10:21 | 1.1M | |
| Deadbridge Chant-m3c..> | 2024-08-19 10:21 | 1.1M | |
| Selvala, Explorer Re..> | 2024-08-19 10:21 | 1.1M | |
| Tidespout Tyrant-rvr..> | 2024-08-19 10:21 | 1.1M | |
| Snakeform-clu-209.png | 2024-08-19 10:21 | 1.1M | |
| Epic Experiment-otc-..> | 2024-08-19 10:21 | 1.1M | |
| Oviya Pashiri, Sage ..> | 2024-08-19 10:21 | 1.2M | |
| Yisan, the Wanderer ..> | 2024-08-19 10:21 | 1.2M | |
| Waste Not-wot-38.png | 2024-08-19 10:21 | 1.2M | |
| Whisperwood Elementa..> | 2024-08-19 10:21 | 1.2M | |
| Exalted Angel-mkc-63..> | 2024-08-19 10:21 | 1.2M | |
| Illusionist's Bracer..> | 2024-08-19 10:21 | 1.2M | |
| Sangromancer-scd-103..> | 2024-08-19 10:21 | 1.2M | |
| Icatian Javelineers-..> | 2024-08-19 10:21 | 1.3M | |
| Fact or Fiction-dmr-..> | 2024-08-19 10:21 | 1.3M | |
| Abundance-cmm-884.png | 2024-08-19 10:21 | 1.3M | |
| Teferi's Protection-..> | 2024-08-19 10:21 | 1.3M | |
| Mentor of the Meek-o..> | 2024-08-19 10:21 | 1.3M | |
| Chain Reaction-scd-1..> | 2024-08-19 10:21 | 1.4M | |
| Triad of Fates-ths-2..> | 2024-08-19 10:21 | 1.4M | |
| Brainstorm-ddj-13.png | 2024-08-19 10:21 | 1.4M | |
| Mind's Desire-c21-12..> | 2024-08-19 10:21 | 1.4M | |
| Chain Lightning-dmr-..> | 2024-08-19 10:21 | 1.4M | |
| Archangel of Thune-i..> | 2024-08-19 10:21 | 1.4M | |
| Elesh Norn, Grand Ce..> | 2024-08-19 10:21 | 1.4M | |
| Assemble the Legion-..> | 2024-08-19 10:21 | 1.4M | |
| Drogskol Reaver-2x2-..> | 2024-08-19 10:21 | 1.4M | |
| Venser, Shaper Savan..> | 2024-08-19 10:21 | 1.4M | |
| Archmage Ascension-z..> | 2024-08-19 10:21 | 1.5M | |
| Rekindling Phoenix-n..> | 2024-08-19 10:21 | 1.5M | |
| Plains-m21-261.png | 2024-08-19 10:21 | 1.5M | |
| Undead Alchemist-mic..> | 2024-08-19 10:21 | 1.5M | |
| Eye of the Storm-rav..> | 2024-08-19 10:21 | 1.5M | |
| Cast Through Time-ro..> | 2024-08-19 10:21 | 1.5M | |
| Jeskai Ascendancy-2x..> | 2024-08-19 10:21 | 1.5M | |
| Upheaval-mh2-270.png | 2024-08-19 10:21 | 1.5M | |
| Bounty of the Luxa-2..> | 2024-08-19 10:21 | 1.5M | |
| Notion Thief-znc-96.png | 2024-08-19 10:21 | 1.5M | |
| Arjun, the Shifting ..> | 2024-08-19 10:21 | 1.5M | |
| Unburial Rites-uma-1..> | 2024-08-19 10:21 | 1.5M | |
| Island-soi-288.png | 2024-08-19 10:21 | 1.5M | |
| Galepowder Mage-ddi-..> | 2024-08-19 10:21 | 1.5M | |
| Hex-c19-120.png | 2024-08-19 10:21 | 1.5M | |
| Ghastly Conscription..> | 2024-08-19 10:21 | 1.5M | |
| Maelstrom Nexus-plst..> | 2024-08-19 10:21 | 1.5M | |
| Necropotence-ema-98.png | 2024-08-19 10:21 | 1.5M | |
| Reassembling Skeleto..> | 2024-08-19 10:21 | 1.5M | |
| Fractured Loyalty-mr..> | 2024-08-19 10:21 | 1.5M | |
| Balance-sld-173.png | 2024-08-19 10:21 | 1.5M | |
| Seat of the Synod-mr..> | 2024-08-19 10:21 | 1.5M | |
| Back from the Brink-..> | 2024-08-19 10:21 | 1.5M | |
| Spell Queller-emn-18..> | 2024-08-19 10:21 | 1.5M | |
| Commandeer-otp-9.png | 2024-08-19 10:21 | 1.5M | |
| Counterbalance-csp-3..> | 2024-08-19 10:21 | 1.5M | |
| Conjured Currency-rt..> | 2024-08-19 10:21 | 1.5M | |
| Strionic Resonator-c..> | 2024-08-19 10:21 | 1.5M | |
| Parallax Wave-plst-N..> | 2024-08-19 10:21 | 1.5M | |
| Howling Mine-brr-20.png | 2024-08-19 10:21 | 1.5M | |
| Mycosynth Lattice-bb..> | 2024-08-19 10:21 | 1.5M | |
| Disciple of Bolas-c2..> | 2024-08-19 10:21 | 1.5M | |
| Jace's Mindseeker-dd..> | 2024-08-19 10:21 | 1.6M | |
| Mesmeric Orb-2xm-272..> | 2024-08-19 10:21 | 1.6M | |
| Gifts Ungiven-ss1-5.png | 2024-08-19 10:21 | 1.6M | |
| Sylvan Library-ema-1..> | 2024-08-19 10:21 | 1.6M | |
| Mikaeus, the Unhallo..> | 2024-08-19 10:21 | 1.6M | |
| Reforge the Soul-avr..> | 2024-08-19 10:21 | 1.6M | |
| Tomorrow, Azami's Fa..> | 2024-08-19 10:21 | 1.6M | |
| Paradox Haze-tsp-71.png | 2024-08-19 10:21 | 1.6M | |
| Aethermage's Touch-c..> | 2024-08-19 10:21 | 1.6M | |
| Geistblast-soi-160.png | 2024-08-19 10:21 | 1.6M | |
| Tibalt, the Fiend-Bl..> | 2024-08-19 10:21 | 1.6M | |
| Cauldron of Souls-cm..> | 2024-08-19 10:21 | 1.6M | |
| Jötun Grunt-plst-CS..> | 2024-08-19 10:21 | 1.6M | |
| Hamletback Goliath-c..> | 2024-08-19 10:21 | 1.6M | |
| Perplexing Chimera-b..> | 2024-08-19 10:21 | 1.6M | |
| Seasons Past-soi-226..> | 2024-08-19 10:21 | 1.6M | |
| Familiar's Ruse-mm3-..> | 2024-08-19 10:21 | 1.6M | |
| Teferi's Imp-mir-98.png | 2024-08-19 10:21 | 1.6M | |
| Rite of Replication-..> | 2024-08-19 10:21 | 1.6M | |
| Oblivion Ring-m12-27..> | 2024-08-19 10:21 | 1.6M | |
| Dominus of Fealty-pl..> | 2024-08-19 10:21 | 1.6M | |
| Healer's Headdress-5..> | 2024-08-19 10:21 | 1.6M | |
| Millikin-mh2-297.png | 2024-08-19 10:21 | 1.6M | |
| Dualcaster Mage-ema-..> | 2024-08-19 10:21 | 1.6M | |
| Knowledge Pool-mbs-1..> | 2024-08-19 10:21 | 1.6M | |
| Archaeomancer-m14-43..> | 2024-08-19 10:21 | 1.6M | |
| Green Sun's Zenith-m..> | 2024-08-19 10:21 | 1.6M | |
| Vault of Whispers-mr..> | 2024-08-19 10:21 | 1.6M | |
| Jabari's Influence-m..> | 2024-08-19 10:21 | 1.6M | |
| Prototype Portal-c18..> | 2024-08-19 10:21 | 1.6M | |
| Seize the Soul-gpt-6..> | 2024-08-19 10:21 | 1.6M | |
| Master of the Feast-..> | 2024-08-19 10:21 | 1.6M | |
| Timesifter-mrd-262.png | 2024-08-19 10:21 | 1.6M | |
| Panglacial Wurm-plst..> | 2024-08-19 10:21 | 1.6M | |
| Shifting Shadow-nec-..> | 2024-08-19 10:21 | 1.6M | |
| Mosswort Bridge-c20-..> | 2024-08-19 10:21 | 1.6M | |
| Aether Membrane-ddi-..> | 2024-08-19 10:21 | 1.6M | |
| Djinn Illuminatus-gp..> | 2024-08-19 10:21 | 1.6M | |
| Genesis Chamber-dst-..> | 2024-08-19 10:21 | 1.6M | |
| Chronosavant-tsp-9.png | 2024-08-19 10:21 | 1.6M | |
| Wild Guess-m13-157.png | 2024-08-19 10:21 | 1.6M | |
| Thopter Assembly-ddu..> | 2024-08-19 10:21 | 1.6M | |
| Guild Feud-rtr-97.png | 2024-08-19 10:21 | 1.6M | |
| Cephalid Illusionist..> | 2024-08-19 10:21 | 1.6M | |
| Erase-ktk-9.png | 2024-08-19 10:21 | 1.6M | |
| Mass Hysteria-mrd-99..> | 2024-08-19 10:21 | 1.6M | |
| Evolutionary Leap-ts..> | 2024-08-19 10:21 | 1.6M | |
| Doubling Season-rav-..> | 2024-08-19 10:21 | 1.7M | |
| Warp World-rav-150.png | 2024-08-19 10:21 | 1.7M | |
| Time Stop-10e-117.png | 2024-08-19 10:21 | 1.7M | |
| Consecrated Sphinx-m..> | 2024-08-19 10:21 | 1.7M | |
| Academy Ruins-tsp-26..> | 2024-08-19 10:21 | 1.7M | |
| Flaming Gambit-tor-9..> | 2024-08-19 10:21 | 1.7M | |
| Teferi's Realm-vis-4..> | 2024-08-19 10:21 | 1.7M | |
| Dead Ringers-apc-37.png | 2024-08-19 10:21 | 1.7M | |
| Prosperity-vis-40.png | 2024-08-19 10:21 | 1.7M | |
| Confusion in the Ran..> | 2024-08-19 10:21 | 1.7M | |
| Iona, Shield of Emer..> | 2024-08-19 10:21 | 1.7M | |
| Reverberate-m12-152.png | 2024-08-19 10:21 | 1.7M | |
| Abeyance-wth-1.png | 2024-08-19 10:21 | 1.7M | |
| Temporal Distortion-..> | 2024-08-19 10:21 | 1.7M | |
| Magus of the Taberna..> | 2024-08-19 10:21 | 1.7M | |
| Endless Whispers-5dn..> | 2024-08-19 10:21 | 1.7M | |
| Norin the Wary-tsp-1..> | 2024-08-19 10:21 | 1.7M | |
| Winding Constrictor-..> | 2024-08-19 10:21 | 1.7M | |
| March of the Machine..> | 2024-08-19 10:21 | 1.7M | |
| Deathgreeter-ala-71.png | 2024-08-19 10:21 | 1.7M | |
| Oracle en-Vec-tmp-31..> | 2024-08-19 10:21 | 1.7M | |
| Conflux-con-102.png | 2024-08-19 10:21 | 1.7M | |
| Living End-tsp-115.png | 2024-08-19 10:21 | 1.7M | |
| Opalescence-uds-13.png | 2024-08-19 10:21 | 1.7M | |
| Soul of the Harvest-..> | 2024-08-19 10:21 | 1.7M | |
| Moonring Mirror-chk-..> | 2024-08-19 10:21 | 1.7M | |
| Contagion Engine-som..> | 2024-08-19 10:21 | 1.7M | |
| Bludgeon Brawl-nph-8..> | 2024-08-19 10:21 | 1.7M | |
| Rings of Brightheart..> | 2024-08-19 10:21 | 1.7M | |
| Dubious Challenge-kl..> | 2024-08-19 10:21 | 1.7M | |
| Bazaar Trader-wwk-72..> | 2024-08-19 10:21 | 1.7M | |
| Ancestral Memories-7..> | 2024-08-19 10:21 | 1.7M | |
| Torrent of Lava-mir-..> | 2024-08-19 10:21 | 1.7M | |
| Myr Propagator-som-1..> | 2024-08-19 10:21 | 1.7M | |
| Praetor's Grasp-nph-..> | 2024-08-19 10:21 | 1.7M | |
| Palinchron-ulg-38.png | 2024-08-19 10:21 | 1.7M | |
| Amber Prison-6ed-272..> | 2024-08-19 10:21 | 1.7M | |
| Telim'Tor's Edict-mi..> | 2024-08-19 10:21 | 1.7M | |
| Forest-ori-272.png | 2024-08-19 10:21 | 1.7M | |
| Nether Shadow-4ed-14..> | 2024-08-19 10:21 | 1.7M | |
| Scoria Wurm-10e-227.png | 2024-08-19 10:21 | 1.7M | |
| Humility-tmp-24.png | 2024-08-19 10:21 | 1.8M | |
| Opal Gargoyle-usg-25..> | 2024-08-19 10:21 | 1.8M | |
| Gamekeeper-cns-165.png | 2024-08-19 10:21 | 1.8M | |
| Staff of Domination-..> | 2024-08-19 10:21 | 1.8M | |
| See the Unwritten-kt..> | 2024-08-19 10:21 | 1.8M | |
| Hive Mind-m10-54.png | 2024-08-19 10:21 | 1.8M | |
| Garruk's Horde-w17-2..> | 2024-08-19 10:21 | 1.8M | |
| Gruul Ragebeast-gtc-..> | 2024-08-19 10:21 | 1.8M | |
| Temple Bell-c13-265.png | 2024-08-19 10:21 | 1.8M | |
| Sudden Spoiling-c14-..> | 2024-08-19 10:21 | 1.8M | |
| Icatian Moneychanger..> | 2024-08-19 10:21 | 1.8M | |
| Tidings-9ed-106.png | 2024-08-19 10:21 | 1.8M | |
| Despondency-usg-129.png | 2024-08-19 10:21 | 1.8M | |
| Wheel of Fate-plst-C..> | 2024-08-19 10:21 | 1.8M | |
| Portent-5ed-110.png | 2024-08-19 10:21 | 1.8M | |
| Wild Pair-plc-144.png | 2024-08-19 10:21 | 1.8M | |
| Mountain-m15-263.png | 2024-08-19 10:21 | 1.8M | |
| Fecundity-8ed-247.png | 2024-08-19 10:21 | 1.8M | |
| Vedalken Orrery-cns-..> | 2024-08-19 10:21 | 1.8M | |
| Swamp-m15-260.png | 2024-08-19 10:21 | 1.8M | |
| Might Makes Right-m1..> | 2024-08-19 10:21 | 1.8M | |
| Akroma's Memorial-fu..> | 2024-08-19 10:21 | 1.9M | |
| Pyroblast-5ed-262.png | 2024-08-19 10:21 | 1.9M | |
| Lim-Dûl's Vault-all..> | 2024-08-19 10:21 | 1.9M | |
| Takklemaggot-chr-37.png | 2024-08-19 10:21 | 1.9M | |
| Mirrorweave-c16-234.png | 2024-08-19 10:21 | 1.9M | |
| Wheel of Fortune-sum..> | 2024-08-19 10:21 | 1.9M | |
| Phyrexian Devourer-a..> | 2024-08-19 10:21 | 1.9M | |
| Baton of Morale-ice-..> | 2024-08-19 10:21 | 1.9M | |
| Ice Cauldron-ice-321..> | 2024-08-19 10:21 | 2.0M | |
| Illusionary Mask-2ed..> | 2024-08-19 10:21 | 2.1M | |
| Raging River-2ed-169..> | 2024-08-19 10:21 | 2.1M | |
| Wrath of God-sum-46.png | 2024-08-19 10:21 | 2.1M | |
| Chains of Mephistoph..> | 2024-08-19 10:21 | 2.1M | |
![[ ]](/icons/compressed.gif) | judge-tower.zip | 2024-08-19 11:27 | 303M | |
|
|---|
